C15H16N2O — CID 13212017
4-benzyl-2-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 13212017) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-benzyl-2-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 4-benzyl-2-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 13212017 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-benzyl-2-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | CC1CN(Cc2ccccc2)c2ncccc2O1 |
| InChI | InChI=1S/C15H16N2O/c1-12-10-17(11-13-6-3-2-4-7-13)15-14(18-12)8-5-9-16-15/h2-9,12H,10-11H2,1H3 |
| InChIKey | HDZGWKOFFUCIQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |