C25H24N8O2 — CID 142744959
4-[(4-methoxyphenyl)methyl]-2-[[6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 142744959) has the molecular formula C25H24N8O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-2-[[6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-2-[[6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 142744959 |
| Molecular Formula | C25H24N8O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-2-[[6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | COc1ccc(CN2CC(Cc3nnc4ccc(-c5cnn(C)c5)nn34)Oc3cccnc32)cc1 |
| InChI | InChI=1S/C25H24N8O2/c1-31-15-18(13-27-31)21-9-10-23-28-29-24(33(23)30-21)12-20-16-32(25-22(35-20)4-3-11-26-25)14-17-5-7-19(34-2)8-6-17/h3-11,13,15,20H,12,14,16H2,1-2H3 |
| InChIKey | BYJCCBCUAJFOPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |