C35H31F7N8O3 — CID 142746999
N-[4-[4-[4-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-(5-oxo-1H-tetrazol-4-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide (PubChem CID 142746999) has the molecular formula C35H31F7N8O3 and a molecular weight of 744.67 g/mol. Its IUPAC name is N-[4-[4-[4-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-(5-oxo-1H-tetrazol-4-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide.
| Compound Name | N-[4-[4-[4-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-(5-oxo-1H-tetrazol-4-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide |
|---|---|
| PubChem CID | 142746999 |
| Molecular Formula | C35H31F7N8O3 |
| Molecular Weight | 744.67 g/mol |
| Exact Mass | 744.24 |
| IUPAC Name | N-[4-[4-[4-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-(5-oxo-1H-tetrazol-4-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide |
| SMILES | C[C@](c1ccc(F)cc1F)(n1nn[nH]c1=O)C(F)(F)c1ccc(-c2ccc(N3CCN(c4ccc(NC(=O)C(O)CC(F)(F)F)cc4)CC3)cc2)cn1 |
| InChI | InChI=1S/C35H31F7N8O3/c1-33(50-32(53)45-46-47-50,27-12-5-23(36)18-28(27)37)35(41,42)30-13-4-22(20-43-30)21-2-8-25(9-3-21)48-14-16-49(17-15-48)26-10-6-24(7-11-26)44-31(52)29(51)19-34(38,39)40/h2-13,18,20,29,51H,14-17,19H2,1H3,(H,44,52)(H,45,47,53)/t29?,33-/m1/s1 |
| InChIKey | NHDYSQRKYBKEHG-FYEOKJGGSA-N |
| XLogP | 5.44 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|