C22H32FN3O2 — CID 142748776
tert-butyl 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate (PubChem CID 142748776) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is tert-butyl 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate.
| Compound Name | tert-butyl 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 142748776 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | tert-butyl 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=CCN1CCC(F)(CCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C22H32FN3O2/c1-21(2,3)28-19(27)7-5-14-26-15-12-22(23,16-26)11-10-18-9-8-17-6-4-13-24-20(17)25-18/h5,7-9H,4,6,10-16H2,1-3H3,(H,24,25) |
| InChIKey | KECHQNKDFKUXLD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|