C22H19ClN6O4 — CID 142749489
(E)-3-[4-[[4-[(7-chloro-3-methoxyimino-2-oxoindol-1-yl)methyl]triazol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 142749489) has the molecular formula C22H19ClN6O4 and a molecular weight of 466.89 g/mol. Its IUPAC name is (E)-3-[4-[[4-[(7-chloro-3-methoxyimino-2-oxoindol-1-yl)methyl]triazol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[4-[(7-chloro-3-methoxyimino-2-oxoindol-1-yl)methyl]triazol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 142749489 |
| Molecular Formula | C22H19ClN6O4 |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (E)-3-[4-[[4-[(7-chloro-3-methoxyimino-2-oxoindol-1-yl)methyl]triazol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CON=C1C(=O)N(Cc2cn(Cc3ccc(/C=C/C(=O)NO)cc3)nn2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C22H19ClN6O4/c1-33-26-20-17-3-2-4-18(23)21(17)29(22(20)31)13-16-12-28(27-24-16)11-15-7-5-14(6-8-15)9-10-19(30)25-32/h2-10,12,32H,11,13H2,1H3,(H,25,30)/b10-9+,26-20? |
| InChIKey | WMSMOOHBUUQPEP-IRGBHNKNSA-N |
| XLogP | 2.40 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|