C19H16ClN3O4 — CID 142732110
(E)-3-[4-[[(3Z)-5-chloro-3-methoxyimino-2-oxoindol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 142732110) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is (E)-3-[4-[[(3Z)-5-chloro-3-methoxyimino-2-oxoindol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[(3Z)-5-chloro-3-methoxyimino-2-oxoindol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 142732110 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (E)-3-[4-[[(3Z)-5-chloro-3-methoxyimino-2-oxoindol-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CO/N=C1\C(=O)N(Cc2ccc(/C=C/C(=O)NO)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H16ClN3O4/c1-27-22-18-15-10-14(20)7-8-16(15)23(19(18)25)11-13-4-2-12(3-5-13)6-9-17(24)21-26/h2-10,26H,11H2,1H3,(H,21,24)/b9-6+,22-18- |
| InChIKey | YDKPGQZFCJIBHO-UAWJGFCLSA-N |
| XLogP | 2.76 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|