C7H10ClNS — CID 142749571
2-chloro-2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine (PubChem CID 142749571) has the molecular formula C7H10ClNS and a molecular weight of 175.68 g/mol. Its IUPAC name is 2-chloro-2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine.
| Compound Name | 2-chloro-2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 142749571 |
| Molecular Formula | C7H10ClNS |
| Molecular Weight | 175.68 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 2-chloro-2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine |
| SMILES | ClC1C=C2CNCCC2S1 |
| InChI | InChI=1S/C7H10ClNS/c8-7-3-5-4-9-2-1-6(5)10-7/h3,6-7,9H,1-2,4H2 |
| InChIKey | NSRVJRAAEJAPPN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|