C7H12ClNS — CID 141264950
2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;hydrochloride (PubChem CID 141264950) has the molecular formula C7H12ClNS and a molecular weight of 177.70 g/mol. Its IUPAC name is 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;hydrochloride.
| Compound Name | 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 141264950 |
| Molecular Formula | C7H12ClNS |
| Molecular Weight | 177.70 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;hydrochloride |
| SMILES | C1=C2CNCCC2SC1.Cl |
| InChI | InChI=1S/C7H11NS.ClH/c1-3-8-5-6-2-4-9-7(1)6;/h2,7-8H,1,3-5H2;1H |
| InChIKey | UFALTADDCAAPTE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.70 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|