C7H10ClNOS — CID 23435874
5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-one;hydrochloride (PubChem CID 23435874) has the molecular formula C7H10ClNOS and a molecular weight of 191.68 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-one;hydrochloride.
| Compound Name | 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 23435874 |
| Molecular Formula | C7H10ClNOS |
| Molecular Weight | 191.68 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-one;hydrochloride |
| SMILES | Cl.O=C1C=C2CNCCC2S1 |
| InChI | InChI=1S/C7H9NOS.ClH/c9-7-3-5-4-8-2-1-6(5)10-7;/h3,6,8H,1-2,4H2;1H |
| InChIKey | PUQKTVAKLPDUAW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|