C8H9NOS — CID 175958536
5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-ylidenemethanone (PubChem CID 175958536) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-ylidenemethanone.
| Compound Name | 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-ylidenemethanone |
|---|---|
| PubChem CID | 175958536 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-ylidenemethanone |
| SMILES | O=C=C1C=C2CNCCC2S1 |
| InChI | InChI=1S/C8H9NOS/c10-5-7-3-6-4-9-2-1-8(6)11-7/h3,8-9H,1-2,4H2 |
| InChIKey | KGOFTUYDXDGNQM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|