C9H17NS — CID 144913842
2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;ethane (PubChem CID 144913842) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;ethane.
| Compound Name | 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;ethane |
|---|---|
| PubChem CID | 144913842 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2,4,5,6,7,7a-hexahydrothieno[3,2-c]pyridine;ethane |
| SMILES | C1=C2CNCCC2SC1.CC |
| InChI | InChI=1S/C7H11NS.C2H6/c1-3-8-5-6-2-4-9-7(1)6;1-2/h2,7-8H,1,3-5H2;1-2H3 |
| InChIKey | UPLNAVNYHUUALY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|