C15H15BrClNO2 — CID 1427502
(2S)-2-[(1S)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinoline (PubChem CID 1427502) has the molecular formula C15H15BrClNO2 and a molecular weight of 356.65 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinoline.
| Compound Name | (2S)-2-[(1S)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 1427502 |
| Molecular Formula | C15H15BrClNO2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2S)-2-[(1S)-1-bromo-1-chloroethyl]-8-methoxy-4-methyl-2,3-dihydrofuro[3,2-c]quinoline |
| SMILES | COc1ccc2nc(C)c3c(c2c1)O[C@H]([C@@](C)(Cl)Br)C3 |
| InChI | InChI=1S/C15H15BrClNO2/c1-8-10-7-13(15(2,16)17)20-14(10)11-6-9(19-3)4-5-12(11)18-8/h4-6,13H,7H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | LGFBGYAWBRSPFU-DZGCQCFKSA-N |
| XLogP | 4.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|