C22H26FN3O4S — CID 142750252
4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-[2-(2-fluorophenoxy)ethyl]benzenesulfonamide (PubChem CID 142750252) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-[2-(2-fluorophenoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-[2-(2-fluorophenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142750252 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-[2-(2-fluorophenoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1c(C(C)C)c(=O)n(-c2ccc(S(=O)(=O)NCCOc3ccccc3F)cc2)n1C |
| InChI | InChI=1S/C22H26FN3O4S/c1-15(2)21-16(3)25(4)26(22(21)27)17-9-11-18(12-10-17)31(28,29)24-13-14-30-20-8-6-5-7-19(20)23/h5-12,15,24H,13-14H2,1-4H3 |
| InChIKey | CEALPBAPAXGCIZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|