C12H9F3N2O3S — CID 142750443
5-[4-(trifluoromethoxy)phenyl]sulfonylpyridin-3-amine (PubChem CID 142750443) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)phenyl]sulfonylpyridin-3-amine.
| Compound Name | 5-[4-(trifluoromethoxy)phenyl]sulfonylpyridin-3-amine |
|---|---|
| PubChem CID | 142750443 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 5-[4-(trifluoromethoxy)phenyl]sulfonylpyridin-3-amine |
| SMILES | Nc1cncc(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C12H9F3N2O3S/c13-12(14,15)20-9-1-3-10(4-2-9)21(18,19)11-5-8(16)6-17-7-11/h1-7H,16H2 |
| InChIKey | LHVDSLPNFBWJEG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |