C23H13F6NO6S2 — CID 71502926
5,8-bis[[4-(trifluoromethoxy)phenyl]sulfonyl]isoquinoline (PubChem CID 71502926) has the molecular formula C23H13F6NO6S2 and a molecular weight of 577.48 g/mol. Its IUPAC name is 5,8-bis[[4-(trifluoromethoxy)phenyl]sulfonyl]isoquinoline.
| Compound Name | 5,8-bis[[4-(trifluoromethoxy)phenyl]sulfonyl]isoquinoline |
|---|---|
| PubChem CID | 71502926 |
| Molecular Formula | C23H13F6NO6S2 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 577.01 |
| IUPAC Name | 5,8-bis[[4-(trifluoromethoxy)phenyl]sulfonyl]isoquinoline |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)c1ccc(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)c2cnccc12 |
| InChI | InChI=1S/C23H13F6NO6S2/c24-22(25,26)35-14-1-5-16(6-2-14)37(31,32)20-9-10-21(19-13-30-12-11-18(19)20)38(33,34)17-7-3-15(4-8-17)36-23(27,28)29/h1-13H |
| InChIKey | OIRBFGZBXKDZCY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |