C22H18F4O5S2 — CID 10345941
2-(2-fluorophenyl)sulfonyl-1-(4-propan-2-ylphenyl)sulfonyl-4-(trifluoromethoxy)benzene (PubChem CID 10345941) has the molecular formula C22H18F4O5S2 and a molecular weight of 502.51 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-1-(4-propan-2-ylphenyl)sulfonyl-4-(trifluoromethoxy)benzene.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-1-(4-propan-2-ylphenyl)sulfonyl-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 10345941 |
| Molecular Formula | C22H18F4O5S2 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-1-(4-propan-2-ylphenyl)sulfonyl-4-(trifluoromethoxy)benzene |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2ccc(OC(F)(F)F)cc2S(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H18F4O5S2/c1-14(2)15-7-10-17(11-8-15)32(27,28)20-12-9-16(31-22(24,25)26)13-21(20)33(29,30)19-6-4-3-5-18(19)23/h3-14H,1-2H3 |
| InChIKey | JDTUYPOUSIKMCH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |