C23H18F4O4S — CID 135053911
[(E)-3,3,3-trifluoro-1-(3-fluorophenyl)-1-(4-methoxyphenyl)prop-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 135053911) has the molecular formula C23H18F4O4S and a molecular weight of 466.45 g/mol. Its IUPAC name is [(E)-3,3,3-trifluoro-1-(3-fluorophenyl)-1-(4-methoxyphenyl)prop-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-3,3,3-trifluoro-1-(3-fluorophenyl)-1-(4-methoxyphenyl)prop-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135053911 |
| Molecular Formula | C23H18F4O4S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [(E)-3,3,3-trifluoro-1-(3-fluorophenyl)-1-(4-methoxyphenyl)prop-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C(=C(\OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H18F4O4S/c1-15-6-12-20(13-7-15)32(28,29)31-22(23(25,26)27)21(17-4-3-5-18(24)14-17)16-8-10-19(30-2)11-9-16/h3-14H,1-2H3/b22-21+ |
| InChIKey | OQELXXPPDCGCOI-QURGRASLSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|