C15H14F3N3O5S — CID 174889373
3-amino-N-ethoxy-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide (PubChem CID 174889373) has the molecular formula C15H14F3N3O5S and a molecular weight of 405.35 g/mol. Its IUPAC name is 3-amino-N-ethoxy-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide.
| Compound Name | 3-amino-N-ethoxy-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 174889373 |
| Molecular Formula | C15H14F3N3O5S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 3-amino-N-ethoxy-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
| SMILES | CCONC(=O)c1ncc(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1N |
| InChI | InChI=1S/C15H14F3N3O5S/c1-2-25-21-14(22)13-12(19)7-11(8-20-13)27(23,24)10-5-3-9(4-6-10)26-15(16,17)18/h3-8H,2,19H2,1H3,(H,21,22) |
| InChIKey | CQIWZLDYSYFWQI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|