C23H22N2O4 — CID 142750900
5-methyl-1,3-bis[[4-(oxiran-2-yl)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 142750900) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-methyl-1,3-bis[[4-(oxiran-2-yl)phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1,3-bis[[4-(oxiran-2-yl)phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142750900 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 5-methyl-1,3-bis[[4-(oxiran-2-yl)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(Cc2ccc(C3CO3)cc2)c(=O)n(Cc2ccc(C3CO3)cc2)c1=O |
| InChI | InChI=1S/C23H22N2O4/c1-15-10-24(11-16-2-6-18(7-3-16)20-13-28-20)23(27)25(22(15)26)12-17-4-8-19(9-5-17)21-14-29-21/h2-10,20-21H,11-14H2,1H3 |
| InChIKey | XDFWKXCKWQIUOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|