C10H12O — CID 40580634
(2S)-2-(3,4-dimethylphenyl)oxirane (PubChem CID 40580634) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenyl)oxirane.
| Compound Name | (2S)-2-(3,4-dimethylphenyl)oxirane |
|---|---|
| PubChem CID | 40580634 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenyl)oxirane |
| SMILES | Cc1ccc([C@H]2CO2)cc1C |
| InChI | InChI=1S/C10H12O/c1-7-3-4-9(5-8(7)2)10-6-11-10/h3-5,10H,6H2,1-2H3/t10-/m1/s1 |
| InChIKey | GMFDVHPDGHUBBS-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|