C18H25N3O5 — CID 142751151
tert-butyl 4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 142751151) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl 4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 142751151 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl 4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)N/N=C/c2ccccc2O)COC1(C)C |
| InChI | InChI=1S/C18H25N3O5/c1-17(2,3)26-16(24)21-13(11-25-18(21,4)5)15(23)20-19-10-12-8-6-7-9-14(12)22/h6-10,13,22H,11H2,1-5H3,(H,20,23)/b19-10+ |
| InChIKey | QIHBFYAORBPSIQ-VXLYETTFSA-N |
| XLogP | 2.21 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|