C15H19BrN2O2 — CID 142752322
5-bromo-9-nitro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene (PubChem CID 142752322) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is 5-bromo-9-nitro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene.
| Compound Name | 5-bromo-9-nitro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 142752322 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5-bromo-9-nitro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])C1Cc2cc(Br)ccc2N2CCCCCCC12 |
| InChI | InChI=1S/C15H19BrN2O2/c16-12-6-7-13-11(9-12)10-15(18(19)20)14-5-3-1-2-4-8-17(13)14/h6-7,9,14-15H,1-5,8,10H2 |
| InChIKey | SQJOMXMJQXDLCV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|