C12H13BrN2O2 — CID 142752313
7-bromo-4-nitro-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoline (PubChem CID 142752313) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 7-bromo-4-nitro-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoline.
| Compound Name | 7-bromo-4-nitro-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoline |
|---|---|
| PubChem CID | 142752313 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 7-bromo-4-nitro-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoline |
| SMILES | O=[N+]([O-])C1Cc2cc(Br)ccc2N2CCCC12 |
| InChI | InChI=1S/C12H13BrN2O2/c13-9-3-4-10-8(6-9)7-12(15(16)17)11-2-1-5-14(10)11/h3-4,6,11-12H,1-2,5,7H2 |
| InChIKey | OHVHWQNQYIUSEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|