C32H42N4O5 — CID 142756729
4-[2-[2-[4-[1-[2-[[2-(4-formylphenyl)-2-oxoethyl]amino]ethyl]piperidin-4-yl]oxypiperidin-1-yl]ethylamino]acetyl]benzaldehyde (PubChem CID 142756729) has the molecular formula C32H42N4O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is 4-[2-[2-[4-[1-[2-[[2-(4-formylphenyl)-2-oxoethyl]amino]ethyl]piperidin-4-yl]oxypiperidin-1-yl]ethylamino]acetyl]benzaldehyde.
| Compound Name | 4-[2-[2-[4-[1-[2-[[2-(4-formylphenyl)-2-oxoethyl]amino]ethyl]piperidin-4-yl]oxypiperidin-1-yl]ethylamino]acetyl]benzaldehyde |
|---|---|
| PubChem CID | 142756729 |
| Molecular Formula | C32H42N4O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 4-[2-[2-[4-[1-[2-[[2-(4-formylphenyl)-2-oxoethyl]amino]ethyl]piperidin-4-yl]oxypiperidin-1-yl]ethylamino]acetyl]benzaldehyde |
| SMILES | O=Cc1ccc(C(=O)CNCCN2CCC(OC3CCN(CCNCC(=O)c4ccc(C=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C32H42N4O5/c37-23-25-1-5-27(6-2-25)31(39)21-33-13-19-35-15-9-29(10-16-35)41-30-11-17-36(18-12-30)20-14-34-22-32(40)28-7-3-26(24-38)4-8-28/h1-8,23-24,29-30,33-34H,9-22H2 |
| InChIKey | BNTVEYLXUOBPBW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|