2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid

C12H16F2O3 — CID 142757051

IUPAC2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid
SMILESCCCCC(OC1=CCC(F)(F)C=C1)C(=O)O
InChIInChI=1S/C12H16F2O3/c1-2-3-4-10(11(15)16)17-9-5-7-12(13,14)8-6-9/h5-7,10H,2-4,8H2,1H3,(H,15,16)
InChIKeyCUZCVSFUIRTRFM-UHFFFAOYSA-N
MW246.25 g/mol
LogP3.13
Rot. Bonds6

About 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid

2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid (PubChem CID 142757051) has the molecular formula C12H16F2O3 and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid.

Molecular Properties

Compound Name2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid
PubChem CID142757051
Molecular FormulaC12H16F2O3
Molecular Weight246.25 g/mol
Exact Mass246.11
IUPAC Name2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid
SMILESCCCCC(OC1=CCC(F)(F)C=C1)C(=O)O
InChIInChI=1S/C12H16F2O3/c1-2-3-4-10(11(15)16)17-9-5-7-12(13,14)8-6-9/h5-7,10H,2-4,8H2,1H3,(H,15,16)
InChIKeyCUZCVSFUIRTRFM-UHFFFAOYSA-N
XLogP3.13
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.25
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid?
The IUPAC name of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid (CID 142757051) is 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid.
What is the SMILES notation for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid?
The canonical SMILES for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid is CCCCC(OC1=CCC(F)(F)C=C1)C(=O)O.
What is the InChIKey of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid?
The InChIKey is CUZCVSFUIRTRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O3/c1-2-3-4-10(11(15)16)17-9-5-7-12(13,14)8-6-9/h5-7,10H,2-4,8H2,1H3,(H,15,16).
What are the key properties of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid?
2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid has a molecular weight of 246.25 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid is sourced from PubChem (CID 142757051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).