C12H16F2O3 — CID 142757051
2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid (PubChem CID 142757051) has the molecular formula C12H16F2O3 and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid.
| Compound Name | 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 142757051 |
| Molecular Formula | C12H16F2O3 |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)oxyhexanoic acid |
| SMILES | CCCCC(OC1=CCC(F)(F)C=C1)C(=O)O |
| InChI | InChI=1S/C12H16F2O3/c1-2-3-4-10(11(15)16)17-9-5-7-12(13,14)8-6-9/h5-7,10H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | CUZCVSFUIRTRFM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |