C20H29F3O4 — CID 123828273
8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-3-(1,1,1-trifluorobut-2-en-2-yl)nona-3,5,7-trienoic acid (PubChem CID 123828273) has the molecular formula C20H29F3O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-3-(1,1,1-trifluorobut-2-en-2-yl)nona-3,5,7-trienoic acid.
| Compound Name | 8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-3-(1,1,1-trifluorobut-2-en-2-yl)nona-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 123828273 |
| Molecular Formula | C20H29F3O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-3-(1,1,1-trifluorobut-2-en-2-yl)nona-3,5,7-trienoic acid |
| SMILES | CC=C(C(=C(C)C(C)=CC=C(C)OC)C(OC(C)(C)C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C20H29F3O4/c1-9-15(20(21,22)23)16(17(18(24)25)27-19(5,6)7)14(4)12(2)10-11-13(3)26-8/h9-11,17H,1-8H3,(H,24,25) |
| InChIKey | NISGKNFGQOXQCP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|