C21H25F3O6 — CID 143043804
2-[4-[2-hydroxy-3-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]oxypropoxy]-6-methylcyclohepta-1,3,5-trien-1-yl]oxyacetic acid (PubChem CID 143043804) has the molecular formula C21H25F3O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-[4-[2-hydroxy-3-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]oxypropoxy]-6-methylcyclohepta-1,3,5-trien-1-yl]oxyacetic acid.
| Compound Name | 2-[4-[2-hydroxy-3-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]oxypropoxy]-6-methylcyclohepta-1,3,5-trien-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 143043804 |
| Molecular Formula | C21H25F3O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[4-[2-hydroxy-3-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]oxypropoxy]-6-methylcyclohepta-1,3,5-trien-1-yl]oxyacetic acid |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)OCC(O)COC1=CC=C(OCC(=O)O)CC(C)=C1 |
| InChI | InChI=1S/C21H25F3O6/c1-4-17(6-5-15(3)21(22,23)24)28-11-16(25)12-29-18-7-8-19(10-14(2)9-18)30-13-20(26)27/h4-9,16,25H,1,10-13H2,2-3H3,(H,26,27)/b15-5+,17-6+ |
| InChIKey | PXJINYUZASNNTB-SYRYSZLJSA-N |
| XLogP | 4.18 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|