C20H28O5 — CID 142024263
2-[(3Z)-4-[[(2E,4Z)-1-but-3-enoxyhexa-2,4-dien-3-yl]oxymethyl]-2-methylhexa-1,3,5-trien-3-yl]oxyacetic acid (PubChem CID 142024263) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[(3Z)-4-[[(2E,4Z)-1-but-3-enoxyhexa-2,4-dien-3-yl]oxymethyl]-2-methylhexa-1,3,5-trien-3-yl]oxyacetic acid.
| Compound Name | 2-[(3Z)-4-[[(2E,4Z)-1-but-3-enoxyhexa-2,4-dien-3-yl]oxymethyl]-2-methylhexa-1,3,5-trien-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 142024263 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(3Z)-4-[[(2E,4Z)-1-but-3-enoxyhexa-2,4-dien-3-yl]oxymethyl]-2-methylhexa-1,3,5-trien-3-yl]oxyacetic acid |
| SMILES | C=CCCOC/C=C(\C=C/C)OC/C(C=C)=C(\OCC(=O)O)C(=C)C |
| InChI | InChI=1S/C20H28O5/c1-6-9-12-23-13-11-18(10-7-2)24-14-17(8-3)20(16(4)5)25-15-19(21)22/h6-8,10-11H,1,3-4,9,12-15H2,2,5H3,(H,21,22)/b10-7-,18-11+,20-17- |
| InChIKey | KYQCRLMEMJQPND-PUUUNVSISA-N |
| XLogP | 4.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|