C25H37F3O6 — CID 143043821
ethane;2-methoxy-5-(trifluoromethyl)cyclohepta-1,3,5-triene;methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate (PubChem CID 143043821) has the molecular formula C25H37F3O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethane;2-methoxy-5-(trifluoromethyl)cyclohepta-1,3,5-triene;methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate.
| Compound Name | ethane;2-methoxy-5-(trifluoromethyl)cyclohepta-1,3,5-triene;methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate |
|---|---|
| PubChem CID | 143043821 |
| Molecular Formula | C25H37F3O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | ethane;2-methoxy-5-(trifluoromethyl)cyclohepta-1,3,5-triene;methyl 2-[(3Z,5E)-5-(2-hydroxypropoxy)octa-1,3,5-trien-2-yl]oxyacetate |
| SMILES | C=C(/C=C\C(=C/CC)OCC(C)O)OCC(=O)OC.CC.COC1=CCC=C(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C14H22O5.C9H9F3O.C2H6/c1-5-6-13(19-9-11(2)15)8-7-12(3)18-10-14(16)17-4;1-13-8-4-2-3-7(5-6-8)9(10,11)12;1-2/h6-8,11,15H,3,5,9-10H2,1-2,4H3;3-6H,2H2,1H3;1-2H3/b8-7-,13-6+;; |
| InChIKey | VHAFSGLVGXVZPS-BEBWKUSSSA-N |
| XLogP | 5.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|