C12H22O4 — CID 170598376
ethane;methanol;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyacetic acid (PubChem CID 170598376) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is ethane;methanol;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyacetic acid.
| Compound Name | ethane;methanol;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 170598376 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethane;methanol;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyacetic acid |
| SMILES | C=C(C)/C=C\C(=C)OCC(=O)O.CC.CO |
| InChI | InChI=1S/C9H12O3.C2H6.CH4O/c1-7(2)4-5-8(3)12-6-9(10)11;2*1-2/h4-5H,1,3,6H2,2H3,(H,10,11);1-2H3;2H,1H3/b5-4-;; |
| InChIKey | XRXKUDZINGXQGG-WNCVTPEDSA-N |
| XLogP | 2.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|