C19H25F3O4 — CID 153176887
methyl (4E,6Z,8E)-8-hydroxy-7-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)undeca-4,6,8,10-tetraenoate (PubChem CID 153176887) has the molecular formula C19H25F3O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl (4E,6Z,8E)-8-hydroxy-7-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)undeca-4,6,8,10-tetraenoate.
| Compound Name | methyl (4E,6Z,8E)-8-hydroxy-7-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)undeca-4,6,8,10-tetraenoate |
|---|---|
| PubChem CID | 153176887 |
| Molecular Formula | C19H25F3O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl (4E,6Z,8E)-8-hydroxy-7-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]-4-(trifluoromethyl)undeca-4,6,8,10-tetraenoate |
| SMILES | C=C/C=C(O)\C(C)=C/C=C(\C(=C)C(OC(C)(C)C)C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C19H25F3O4/c1-8-9-15(23)12(2)10-11-14(19(20,21)22)13(3)16(17(24)25-7)26-18(4,5)6/h8-11,16,23H,1,3H2,2,4-7H3/b12-10-,14-11+,15-9+ |
| InChIKey | WFJFLIYZABOQKT-JWMLVBOSSA-N |
| XLogP | 4.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|