C19H30O4 — CID 123240586
8-methoxy-5-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxy]-3-propan-2-ylidenenona-5,7-dienoic acid (PubChem CID 123240586) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is 8-methoxy-5-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxy]-3-propan-2-ylidenenona-5,7-dienoic acid.
| Compound Name | 8-methoxy-5-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxy]-3-propan-2-ylidenenona-5,7-dienoic acid |
|---|---|
| PubChem CID | 123240586 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 8-methoxy-5-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxy]-3-propan-2-ylidenenona-5,7-dienoic acid |
| SMILES | C=C(C(C)=CC=C(C)OC)C(=C(C)C)C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H30O4/c1-12(2)16(17(18(20)21)23-19(6,7)8)15(5)13(3)10-11-14(4)22-9/h10-11,17H,5H2,1-4,6-9H3,(H,20,21) |
| InChIKey | SSUZPTMZIJILHV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|