C10H9O3Y- — CID 59118127
2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;yttrium (PubChem CID 59118127) has the molecular formula C10H9O3Y- and a molecular weight of 266.08 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;yttrium.
| Compound Name | 2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 59118127 |
| Molecular Formula | C10H9O3Y- |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 2,3,4,6-tetrahydrochromen-6-ide-2-carboxylic acid;yttrium |
| SMILES | O=C(O)C1CCc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C10H9O3.Y/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9;/h2-4,9H,5-6H2,(H,11,12);/q-1; |
| InChIKey | GWGXYVKKBRGVSX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|