C15H12O3 — CID 88780852
2,6-dihydrocyclohepta[h]chromene-2-carboxylic acid (PubChem CID 88780852) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2,6-dihydrocyclohepta[h]chromene-2-carboxylic acid.
| Compound Name | 2,6-dihydrocyclohepta[h]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 88780852 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2,6-dihydrocyclohepta[h]chromene-2-carboxylic acid |
| SMILES | O=C(O)C1C=CC2=CCC3=CC=CC=CC3=C2O1 |
| InChI | InChI=1S/C15H12O3/c16-15(17)13-9-8-11-7-6-10-4-2-1-3-5-12(10)14(11)18-13/h1-5,7-9,13H,6H2,(H,16,17) |
| InChIKey | LNAMREPNNZUSKR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |