C20H32O4 — CID 123833365
3-but-2-en-2-yl-8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid (PubChem CID 123833365) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 3-but-2-en-2-yl-8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid.
| Compound Name | 3-but-2-en-2-yl-8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 123833365 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-but-2-en-2-yl-8-methoxy-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid |
| SMILES | CC=C(C)C(=C(C)C(C)=CC=C(C)OC)C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H32O4/c1-10-13(2)17(18(19(21)22)24-20(6,7)8)16(5)14(3)11-12-15(4)23-9/h10-12,18H,1-9H3,(H,21,22) |
| InChIKey | CDKHKMAUQNIUQY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|