C12H20O4 — CID 123416382
4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid (PubChem CID 123416382) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid.
| Compound Name | 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid |
|---|---|
| PubChem CID | 123416382 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid |
| SMILES | CCC=C(C=C(COC)OC)CCC(=O)O |
| InChI | InChI=1S/C12H20O4/c1-4-5-10(6-7-12(13)14)8-11(16-3)9-15-2/h5,8H,4,6-7,9H2,1-3H3,(H,13,14) |
| InChIKey | KJTNNFIUSYONDB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|