4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid

C12H20O4 — CID 123416382

IUPAC4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid
SMILESCCC=C(C=C(COC)OC)CCC(=O)O
InChIInChI=1S/C12H20O4/c1-4-5-10(6-7-12(13)14)8-11(16-3)9-15-2/h5,8H,4,6-7,9H2,1-3H3,(H,13,14)
InChIKeyKJTNNFIUSYONDB-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.36
Rot. Bonds8

About 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid

4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid (PubChem CID 123416382) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid.

Molecular Properties

Compound Name4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid
PubChem CID123416382
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid
SMILESCCC=C(C=C(COC)OC)CCC(=O)O
InChIInChI=1S/C12H20O4/c1-4-5-10(6-7-12(13)14)8-11(16-3)9-15-2/h5,8H,4,6-7,9H2,1-3H3,(H,13,14)
InChIKeyKJTNNFIUSYONDB-UHFFFAOYSA-N
XLogP2.36
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid?
The IUPAC name of 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid (CID 123416382) is 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid.
What is the SMILES notation for 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid?
The canonical SMILES for 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid is CCC=C(C=C(COC)OC)CCC(=O)O.
What is the InChIKey of 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid?
The InChIKey is KJTNNFIUSYONDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-5-10(6-7-12(13)14)8-11(16-3)9-15-2/h5,8H,4,6-7,9H2,1-3H3,(H,13,14).
What are the key properties of 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid?
4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid has a molecular weight of 228.29 g/mol, XLogP of 2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethoxyprop-1-enyl)hept-4-enoic acid is sourced from PubChem (CID 123416382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).