C27H29FO3 — CID 163593733
2-fluoro-3-[(1Z,3Z,5Z,7E,11Z)-8-[(3E,5Z,7E,9Z)-7-methoxyundeca-1,3,5,7,9-pentaen-3-yl]cyclododeca-1,3,5,7,9,11-hexaen-1-yl]propanoic acid (PubChem CID 163593733) has the molecular formula C27H29FO3 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-fluoro-3-[(1Z,3Z,5Z,7E,11Z)-8-[(3E,5Z,7E,9Z)-7-methoxyundeca-1,3,5,7,9-pentaen-3-yl]cyclododeca-1,3,5,7,9,11-hexaen-1-yl]propanoic acid.
| Compound Name | 2-fluoro-3-[(1Z,3Z,5Z,7E,11Z)-8-[(3E,5Z,7E,9Z)-7-methoxyundeca-1,3,5,7,9-pentaen-3-yl]cyclododeca-1,3,5,7,9,11-hexaen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 163593733 |
| Molecular Formula | C27H29FO3 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-fluoro-3-[(1Z,3Z,5Z,7E,11Z)-8-[(3E,5Z,7E,9Z)-7-methoxyundeca-1,3,5,7,9-pentaen-3-yl]cyclododeca-1,3,5,7,9,11-hexaen-1-yl]propanoic acid |
| SMILES | C=CC(=C\C=C/C(=C\C=C/C)OC)/C1=C/C=C\C=C/C=C(CC(F)C(=O)O)\C=C/C=C1 |
| InChI | InChI=1S/C27H29FO3/c1-4-6-19-25(31-3)20-13-18-23(5-2)24-16-10-8-7-9-14-22(15-11-12-17-24)21-26(28)27(29)30/h4-20,26H,2,21H2,1,3H3,(H,29,30)/b6-4-,8-7-,9-7-,10-8-,12-11?,14-9-,15-11-,16-10-,17-12?,20-13-,22-14+,22-15+,23-18+,24-16+,24-17?,25-19+ |
| InChIKey | GRROVGCKXWAYLH-IQTSDQAVSA-N |
| XLogP | 6.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|