C18H30O4 — CID 131994890
(4Z,6Z)-6,7-dibutoxy-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid (PubChem CID 131994890) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (4Z,6Z)-6,7-dibutoxy-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid.
| Compound Name | (4Z,6Z)-6,7-dibutoxy-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 131994890 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (4Z,6Z)-6,7-dibutoxy-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid |
| SMILES | C/C=C\C(=C/C(=C/OCCCC)OCCCC)CCC(=O)O |
| InChI | InChI=1S/C18H30O4/c1-4-7-12-21-15-17(22-13-8-5-2)14-16(9-6-3)10-11-18(19)20/h6,9,14-15H,4-5,7-8,10-13H2,1-3H3,(H,19,20)/b9-6-,16-14+,17-15- |
| InChIKey | LVWFMTFMYOMRNP-HQISPQHESA-N |
| XLogP | 4.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|