C19H30O4 — CID 123645274
(5E)-3-but-2-en-2-yl-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-8-oxonona-3,5-dienoic acid (PubChem CID 123645274) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (5E)-3-but-2-en-2-yl-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-8-oxonona-3,5-dienoic acid.
| Compound Name | (5E)-3-but-2-en-2-yl-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-8-oxonona-3,5-dienoic acid |
|---|---|
| PubChem CID | 123645274 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (5E)-3-but-2-en-2-yl-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]-8-oxonona-3,5-dienoic acid |
| SMILES | CC=C(C)C(=C(C)/C(C)=C/CC(C)=O)C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H30O4/c1-9-12(2)16(15(5)13(3)10-11-14(4)20)17(18(21)22)23-19(6,7)8/h9-10,17H,11H2,1-8H3,(H,21,22)/b12-9?,13-10+,16-15? |
| InChIKey | JKIHHGZOSMEYDX-ITYVXYNISA-N |
| XLogP | 4.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|