C19H14O4S — CID 142757058
2-(5-methylfuran-2-yl)-3-(thiophene-2-carbonyl)-2,3-dihydrochromen-4-one (PubChem CID 142757058) has the molecular formula C19H14O4S and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-3-(thiophene-2-carbonyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(5-methylfuran-2-yl)-3-(thiophene-2-carbonyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 142757058 |
| Molecular Formula | C19H14O4S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-3-(thiophene-2-carbonyl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc(C2Oc3ccccc3C(=O)C2C(=O)c2cccs2)o1 |
| InChI | InChI=1S/C19H14O4S/c1-11-8-9-14(22-11)19-16(18(21)15-7-4-10-24-15)17(20)12-5-2-3-6-13(12)23-19/h2-10,16,19H,1H3 |
| InChIKey | ISXBDUGBMFHLLT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|