C16H11NO4S — CID 10969019
N-[1,3-dioxo-2-(thiophene-2-carbonyl)inden-4-yl]acetamide (PubChem CID 10969019) has the molecular formula C16H11NO4S and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[1,3-dioxo-2-(thiophene-2-carbonyl)inden-4-yl]acetamide.
| Compound Name | N-[1,3-dioxo-2-(thiophene-2-carbonyl)inden-4-yl]acetamide |
|---|---|
| PubChem CID | 10969019 |
| Molecular Formula | C16H11NO4S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-[1,3-dioxo-2-(thiophene-2-carbonyl)inden-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)C(C(=O)c1cccs1)C2=O |
| InChI | InChI=1S/C16H11NO4S/c1-8(18)17-10-5-2-4-9-12(10)16(21)13(14(9)19)15(20)11-6-3-7-22-11/h2-7,13H,1H3,(H,17,18) |
| InChIKey | PQKFXMKEVQZLAL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|