C19H15NO5 — CID 98061288
N-[(2S)-2-(4-methoxybenzoyl)-1,3-dioxoinden-4-yl]acetamide (PubChem CID 98061288) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxybenzoyl)-1,3-dioxoinden-4-yl]acetamide.
| Compound Name | N-[(2S)-2-(4-methoxybenzoyl)-1,3-dioxoinden-4-yl]acetamide |
|---|---|
| PubChem CID | 98061288 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(2S)-2-(4-methoxybenzoyl)-1,3-dioxoinden-4-yl]acetamide |
| SMILES | COc1ccc(C(=O)[C@H]2C(=O)c3cccc(NC(C)=O)c3C2=O)cc1 |
| InChI | InChI=1S/C19H15NO5/c1-10(21)20-14-5-3-4-13-15(14)19(24)16(18(13)23)17(22)11-6-8-12(25-2)9-7-11/h3-9,16H,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | WMVMOPLFDKWJMQ-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|