C23H23N3O6 — CID 70793127
1-[2-(4-ethoxybenzoyl)-1,3-dioxoinden-4-yl]-3-morpholin-4-ylurea (PubChem CID 70793127) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-[2-(4-ethoxybenzoyl)-1,3-dioxoinden-4-yl]-3-morpholin-4-ylurea.
| Compound Name | 1-[2-(4-ethoxybenzoyl)-1,3-dioxoinden-4-yl]-3-morpholin-4-ylurea |
|---|---|
| PubChem CID | 70793127 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-[2-(4-ethoxybenzoyl)-1,3-dioxoinden-4-yl]-3-morpholin-4-ylurea |
| SMILES | CCOc1ccc(C(=O)C2C(=O)c3cccc(NC(=O)NN4CCOCC4)c3C2=O)cc1 |
| InChI | InChI=1S/C23H23N3O6/c1-2-32-15-8-6-14(7-9-15)20(27)19-21(28)16-4-3-5-17(18(16)22(19)29)24-23(30)25-26-10-12-31-13-11-26/h3-9,19H,2,10-13H2,1H3,(H2,24,25,30) |
| InChIKey | KOMJQPGQJQDHIK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|