C24H17NO5 — CID 11133104
N-[1,3-dioxo-2-(4-phenoxybenzoyl)inden-4-yl]acetamide (PubChem CID 11133104) has the molecular formula C24H17NO5 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-[1,3-dioxo-2-(4-phenoxybenzoyl)inden-4-yl]acetamide.
| Compound Name | N-[1,3-dioxo-2-(4-phenoxybenzoyl)inden-4-yl]acetamide |
|---|---|
| PubChem CID | 11133104 |
| Molecular Formula | C24H17NO5 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[1,3-dioxo-2-(4-phenoxybenzoyl)inden-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)C(C(=O)c1ccc(Oc3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C24H17NO5/c1-14(26)25-19-9-5-8-18-20(19)24(29)21(23(18)28)22(27)15-10-12-17(13-11-15)30-16-6-3-2-4-7-16/h2-13,21H,1H3,(H,25,26) |
| InChIKey | NEQUQEDRDGLNNS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|