C25H25N3O8 — CID 143160800
ethyl 2-[4-[(2S)-4-(morpholin-4-ylcarbamoylamino)-1,3-dioxoindene-2-carbonyl]phenoxy]acetate (PubChem CID 143160800) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is ethyl 2-[4-[(2S)-4-(morpholin-4-ylcarbamoylamino)-1,3-dioxoindene-2-carbonyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2S)-4-(morpholin-4-ylcarbamoylamino)-1,3-dioxoindene-2-carbonyl]phenoxy]acetate |
|---|---|
| PubChem CID | 143160800 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | ethyl 2-[4-[(2S)-4-(morpholin-4-ylcarbamoylamino)-1,3-dioxoindene-2-carbonyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)[C@H]2C(=O)c3cccc(NC(=O)NN4CCOCC4)c3C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O8/c1-2-35-19(29)14-36-16-8-6-15(7-9-16)22(30)21-23(31)17-4-3-5-18(20(17)24(21)32)26-25(33)27-28-10-12-34-13-11-28/h3-9,21H,2,10-14H2,1H3,(H2,26,27,33)/t21-/m0/s1 |
| InChIKey | DCQBVDPIEHABRO-NRFANRHFSA-N |
| XLogP | 1.88 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|