C13H13NO3 — CID 91726094
N-(6-formyl-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)acetamide (PubChem CID 91726094) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(6-formyl-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)acetamide.
| Compound Name | N-(6-formyl-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 91726094 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(6-formyl-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c1CCC(C=O)C2=O |
| InChI | InChI=1S/C13H13NO3/c1-8(16)14-12-4-2-3-11-10(12)6-5-9(7-15)13(11)17/h2-4,7,9H,5-6H2,1H3,(H,14,16) |
| InChIKey | OCUAAZXFQVYHDP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|