C44H36Cl3F6N11O2 — CID 142757890
1,2-bis[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-1-methylguanidine;hydrochloride (PubChem CID 142757890) has the molecular formula C44H36Cl3F6N11O2 and a molecular weight of 971.19 g/mol. Its IUPAC name is 1,2-bis[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-1-methylguanidine;hydrochloride.
| Compound Name | 1,2-bis[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 142757890 |
| Molecular Formula | C44H36Cl3F6N11O2 |
| Molecular Weight | 971.19 g/mol |
| Exact Mass | 969.20 |
| IUPAC Name | 1,2-bis[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-1-methylguanidine;hydrochloride |
| SMILES | CN(CCn1ccc2ncnc(Nc3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21)/C(N)=N/CCn1ccc2ncnc(Nc3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21.Cl |
| InChI | InChI=1S/C44H35Cl2F6N11O2.ClH/c1-61(18-19-63-16-13-35-39(63)41(58-25-56-35)60-29-9-11-37(33(46)23-29)65-31-7-3-5-27(21-31)44(50,51)52)42(53)54-14-17-62-15-12-34-38(62)40(57-24-55-34)59-28-8-10-36(32(45)22-28)64-30-6-2-4-26(20-30)43(47,48)49;/h2-13,15-16,20-25H,14,17-19H2,1H3,(H2,53,54)(H,55,57,59)(H,56,58,60);1H |
| InChIKey | IAGWNZXBPNVLCN-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.19 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|