C24H22ClF3N4O2 — CID 56850806
5-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]pentan-1-ol (PubChem CID 56850806) has the molecular formula C24H22ClF3N4O2 and a molecular weight of 490.91 g/mol. Its IUPAC name is 5-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]pentan-1-ol.
| Compound Name | 5-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]pentan-1-ol |
|---|---|
| PubChem CID | 56850806 |
| Molecular Formula | C24H22ClF3N4O2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]pentan-1-ol |
| SMILES | OCCCCCn1ccc2ncnc(Nc3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C24H22ClF3N4O2/c25-19-14-17(7-8-21(19)34-18-6-4-5-16(13-18)24(26,27)28)31-23-22-20(29-15-30-23)9-11-32(22)10-2-1-3-12-33/h4-9,11,13-15,33H,1-3,10,12H2,(H,29,30,31) |
| InChIKey | MHJBSGVISQZKDI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|