C31H24Cl2F3N5O4 — CID 162313792
2-[2-[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 162313792) has the molecular formula C31H24Cl2F3N5O4 and a molecular weight of 658.46 g/mol. Its IUPAC name is 2-[2-[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 162313792 |
| Molecular Formula | C31H24Cl2F3N5O4 |
| Molecular Weight | 658.46 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 2-[2-[2-[4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CCOCCn1ccc2ncnc(Nc3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C31H23ClF3N5O4.ClH/c32-24-17-20(8-9-26(24)44-21-5-3-4-19(16-21)31(33,34)35)38-28-27-25(36-18-37-28)10-11-39(27)12-14-43-15-13-40-29(41)22-6-1-2-7-23(22)30(40)42;/h1-11,16-18H,12-15H2,(H,36,37,38);1H |
| InChIKey | ZUMQJXCUYCZITO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.46 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|