C25H26ClF2N5O4S — CID 163751834
N-[2-[2-[4-[3-chloro-4-[3-(1,1-difluoroethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]methanesulfonamide (PubChem CID 163751834) has the molecular formula C25H26ClF2N5O4S and a molecular weight of 566.03 g/mol. Its IUPAC name is N-[2-[2-[4-[3-chloro-4-[3-(1,1-difluoroethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[4-[3-chloro-4-[3-(1,1-difluoroethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 163751834 |
| Molecular Formula | C25H26ClF2N5O4S |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | N-[2-[2-[4-[3-chloro-4-[3-(1,1-difluoroethyl)phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyl]methanesulfonamide |
| SMILES | CC(F)(F)c1cccc(Oc2ccc(Nc3ncnc4ccn(CCOCCNS(C)(=O)=O)c34)cc2Cl)c1 |
| InChI | InChI=1S/C25H26ClF2N5O4S/c1-25(27,28)17-4-3-5-19(14-17)37-22-7-6-18(15-20(22)26)32-24-23-21(29-16-30-24)8-10-33(23)11-13-36-12-9-31-38(2,34)35/h3-8,10,14-16,31H,9,11-13H2,1-2H3,(H,29,30,32) |
| InChIKey | LQQDTAMRYCBYOF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|